C9H13NO — CID 29079255
(1S)-1-[(1R,2S)-2-(furan-2-yl)cyclopropyl]ethanamine (PubChem CID 29079255) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (1S)-1-[(1R,2S)-2-(furan-2-yl)cyclopropyl]ethanamine.
| Compound Name | (1S)-1-[(1R,2S)-2-(furan-2-yl)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 29079255 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (1S)-1-[(1R,2S)-2-(furan-2-yl)cyclopropyl]ethanamine |
| SMILES | C[C@H](N)[C@@H]1C[C@@H]1c1ccco1 |
| InChI | InChI=1S/C9H13NO/c1-6(10)7-5-8(7)9-3-2-4-11-9/h2-4,6-8H,5,10H2,1H3/t6-,7-,8-/m0/s1 |
| InChIKey | LVWQLOMGIDANMN-FXQIFTODSA-N |
| XLogP | 1.73 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |