C14H18O7 — CID 159021509
ethane-1,2-diol;furan-2-carbaldehyde;2-(furan-2-yl)-1,3-dioxolane (PubChem CID 159021509) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is ethane-1,2-diol;furan-2-carbaldehyde;2-(furan-2-yl)-1,3-dioxolane.
| Compound Name | ethane-1,2-diol;furan-2-carbaldehyde;2-(furan-2-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 159021509 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | ethane-1,2-diol;furan-2-carbaldehyde;2-(furan-2-yl)-1,3-dioxolane |
| SMILES | O=Cc1ccco1.OCCO.c1coc(C2OCCO2)c1 |
| InChI | InChI=1S/C7H8O3.C5H4O2.C2H6O2/c1-2-6(8-3-1)7-9-4-5-10-7;6-4-5-2-1-3-7-5;3-1-2-4/h1-3,7H,4-5H2;1-4H;3-4H,1-2H2 |
| InChIKey | JTTKZGGFFHAOPD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|