C21H25FO3 — CID 705079
(16R)-16-(4-fluorophenyl)-15-oxadispiro[5.1.58.36]hexadecane-7,14-dione (PubChem CID 705079) has the molecular formula C21H25FO3 and a molecular weight of 344.43 g/mol. Its IUPAC name is (16R)-16-(4-fluorophenyl)-15-oxadispiro[5.1.58.36]hexadecane-7,14-dione.
| Compound Name | (16R)-16-(4-fluorophenyl)-15-oxadispiro[5.1.58.36]hexadecane-7,14-dione |
|---|---|
| PubChem CID | 705079 |
| Molecular Formula | C21H25FO3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (16R)-16-(4-fluorophenyl)-15-oxadispiro[5.1.58.36]hexadecane-7,14-dione |
| SMILES | O=C1O[C@H](c2ccc(F)cc2)C2(CCCCC2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C21H25FO3/c22-16-9-7-15(8-10-16)17-20(11-3-1-4-12-20)18(23)21(19(24)25-17)13-5-2-6-14-21/h7-10,17H,1-6,11-14H2/t17-/m1/s1 |
| InChIKey | LPZPFNMMDIKXPH-QGZVFWFLSA-N |
| XLogP | 4.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|