C12H12Cl4O3 — CID 102322357
(1R,2S,6S,7S)-1,7,8,9-tetrachloro-10,10-dimethoxytricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 102322357) has the molecular formula C12H12Cl4O3 and a molecular weight of 346.04 g/mol. Its IUPAC name is (1R,2S,6S,7S)-1,7,8,9-tetrachloro-10,10-dimethoxytricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | (1R,2S,6S,7S)-1,7,8,9-tetrachloro-10,10-dimethoxytricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 102322357 |
| Molecular Formula | C12H12Cl4O3 |
| Molecular Weight | 346.04 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | (1R,2S,6S,7S)-1,7,8,9-tetrachloro-10,10-dimethoxytricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | COC1(OC)[C@@]2(Cl)C(Cl)C(Cl)[C@]1(Cl)[C@H]1C=CC(=O)[C@H]12 |
| InChI | InChI=1S/C12H12Cl4O3/c1-18-12(19-2)10(15)5-3-4-6(17)7(5)11(12,16)9(14)8(10)13/h3-5,7-9H,1-2H3/t5-,7-,8?,9?,10+,11-/m0/s1 |
| InChIKey | KYDVXMWFUROJOU-ACDDWKSNSA-N |
| XLogP | 2.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.04 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|