C14H16O7 — CID 100968315
trimethyl (1S,6aR)-2-oxo-1,4,6,6a-tetrahydropentalene-1,5,5-tricarboxylate (PubChem CID 100968315) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is trimethyl (1S,6aR)-2-oxo-1,4,6,6a-tetrahydropentalene-1,5,5-tricarboxylate.
| Compound Name | trimethyl (1S,6aR)-2-oxo-1,4,6,6a-tetrahydropentalene-1,5,5-tricarboxylate |
|---|---|
| PubChem CID | 100968315 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | trimethyl (1S,6aR)-2-oxo-1,4,6,6a-tetrahydropentalene-1,5,5-tricarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C=C2CC(C(=O)OC)(C(=O)OC)C[C@@H]21 |
| InChI | InChI=1S/C14H16O7/c1-19-11(16)10-8-6-14(12(17)20-2,13(18)21-3)5-7(8)4-9(10)15/h4,8,10H,5-6H2,1-3H3/t8-,10-/m0/s1 |
| InChIKey | ROQAGMXLHADTFD-WPRPVWTQSA-N |
| XLogP | 0.03 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|