C20H24O10 — CID 117071054
tetramethyl 8,11-dihydroxytricyclo[4.3.3.01,6]dodeca-7,10-diene-7,9,10,12-tetracarboxylate (PubChem CID 117071054) has the molecular formula C20H24O10 and a molecular weight of 424.40 g/mol. Its IUPAC name is tetramethyl 8,11-dihydroxytricyclo[4.3.3.01,6]dodeca-7,10-diene-7,9,10,12-tetracarboxylate.
| Compound Name | tetramethyl 8,11-dihydroxytricyclo[4.3.3.01,6]dodeca-7,10-diene-7,9,10,12-tetracarboxylate |
|---|---|
| PubChem CID | 117071054 |
| Molecular Formula | C20H24O10 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | tetramethyl 8,11-dihydroxytricyclo[4.3.3.01,6]dodeca-7,10-diene-7,9,10,12-tetracarboxylate |
| SMILES | COC(=O)C1=C(O)C(C(=O)OC)C23CCCCC12C(C(=O)OC)C(O)=C3C(=O)OC |
| InChI | InChI=1S/C20H24O10/c1-27-15(23)9-13(21)10(16(24)28-2)20-8-6-5-7-19(9,20)11(17(25)29-3)14(22)12(20)18(26)30-4/h9,12,21-22H,5-8H2,1-4H3 |
| InChIKey | KRFQNBNYNBJKLD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|