C24H22I2O4 — CID 14869188
dimethyl 14,19-diiodoundecacyclo[9.9.0.01,5.02,12.02,18.03,7.06,10.08,12.011,15.013,17.016,20]icosane-4,9-dicarboxylate (PubChem CID 14869188) has the molecular formula C24H22I2O4 and a molecular weight of 628.24 g/mol. Its IUPAC name is dimethyl 14,19-diiodoundecacyclo[9.9.0.01,5.02,12.02,18.03,7.06,10.08,12.011,15.013,17.016,20]icosane-4,9-dicarboxylate.
| Compound Name | dimethyl 14,19-diiodoundecacyclo[9.9.0.01,5.02,12.02,18.03,7.06,10.08,12.011,15.013,17.016,20]icosane-4,9-dicarboxylate |
|---|---|
| PubChem CID | 14869188 |
| Molecular Formula | C24H22I2O4 |
| Molecular Weight | 628.24 g/mol |
| Exact Mass | 627.96 |
| IUPAC Name | dimethyl 14,19-diiodoundecacyclo[9.9.0.01,5.02,12.02,18.03,7.06,10.08,12.011,15.013,17.016,20]icosane-4,9-dicarboxylate |
| SMILES | COC(=O)C1C2C3C4C1C15C6C(I)C7C8C6C6C(I)C8C8(C3C(C(=O)OC)C4C618)C725 |
| InChI | InChI=1S/C24H22I2O4/c1-29-19(27)7-9-3-4-10(7)22-14-6-5-13(17(14)25)21(9,22)23-11(3)8(20(28)30-2)12(4)24(22,23)16(6)18(26)15(5)23/h3-18H,1-2H3 |
| InChIKey | IBHFZPHFOZWOLV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|