C25H24O6 — CID 15046008
dimethyl 14-methoxy-19-oxoundecacyclo[9.9.0.01,5.02,12.02,18.03,7.06,10.08,12.011,15.013,17.016,20]icosane-4,9-dicarboxylate (PubChem CID 15046008) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is dimethyl 14-methoxy-19-oxoundecacyclo[9.9.0.01,5.02,12.02,18.03,7.06,10.08,12.011,15.013,17.016,20]icosane-4,9-dicarboxylate.
| Compound Name | dimethyl 14-methoxy-19-oxoundecacyclo[9.9.0.01,5.02,12.02,18.03,7.06,10.08,12.011,15.013,17.016,20]icosane-4,9-dicarboxylate |
|---|---|
| PubChem CID | 15046008 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | dimethyl 14-methoxy-19-oxoundecacyclo[9.9.0.01,5.02,12.02,18.03,7.06,10.08,12.011,15.013,17.016,20]icosane-4,9-dicarboxylate |
| SMILES | COC(=O)C1C2C3C4C1C15C6C(=O)C7C8C6C6C(OC)C8C8(C3C(C(=O)OC)C4C618)C725 |
| InChI | InChI=1S/C25H24O6/c1-29-19-16-6-7-15-18(26)14(6)22-10-4-5-11(8(10)20(27)30-2)23(15,22)25(17(7)19)13(5)9(21(28)31-3)12(4)24(16,22)25/h4-17,19H,1-3H3 |
| InChIKey | WYJOXVGJHFNGRO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |