C17H20O6 — CID 124895825
dimethyl (1S,2S,3R,6S,7R,8S,9S,10R)-4-(acetyloxymethyl)pentacyclo[4.4.0.02,4.03,8.05,7]decane-9,10-dicarboxylate (PubChem CID 124895825) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is dimethyl (1S,2S,3R,6S,7R,8S,9S,10R)-4-(acetyloxymethyl)pentacyclo[4.4.0.02,4.03,8.05,7]decane-9,10-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3R,6S,7R,8S,9S,10R)-4-(acetyloxymethyl)pentacyclo[4.4.0.02,4.03,8.05,7]decane-9,10-dicarboxylate |
|---|---|
| PubChem CID | 124895825 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | dimethyl (1S,2S,3R,6S,7R,8S,9S,10R)-4-(acetyloxymethyl)pentacyclo[4.4.0.02,4.03,8.05,7]decane-9,10-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@H]2[C@H]3C4[C@H]3[C@H]1[C@@H]1[C@H]2C41COC(C)=O |
| InChI | InChI=1S/C17H20O6/c1-5(18)23-4-17-12-6-7(12)9-11(16(20)22-3)10(15(19)21-2)8(6)13(17)14(9)17/h6-14H,4H2,1-3H3/t6-,7+,8-,9-,10+,11-,12?,13-,14+,17?/m1/s1 |
| InChIKey | SUWDWUSZOHOUOE-NBIPIFGTSA-N |
| XLogP | 0.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|