C17H18O5 — CID 125034090
dimethyl (1S,2S,4R,5R,7R,8S,9S,10S,11R,14R)-3-oxaheptacyclo[6.5.1.02,4.02,7.04,11.05,9.010,14]tetradecane-8,9-dicarboxylate (PubChem CID 125034090) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is dimethyl (1S,2S,4R,5R,7R,8S,9S,10S,11R,14R)-3-oxaheptacyclo[6.5.1.02,4.02,7.04,11.05,9.010,14]tetradecane-8,9-dicarboxylate.
| Compound Name | dimethyl (1S,2S,4R,5R,7R,8S,9S,10S,11R,14R)-3-oxaheptacyclo[6.5.1.02,4.02,7.04,11.05,9.010,14]tetradecane-8,9-dicarboxylate |
|---|---|
| PubChem CID | 125034090 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | dimethyl (1S,2S,4R,5R,7R,8S,9S,10S,11R,14R)-3-oxaheptacyclo[6.5.1.02,4.02,7.04,11.05,9.010,14]tetradecane-8,9-dicarboxylate |
| SMILES | COC(=O)[C@]12[C@@H]3C4CC[C@H]5[C@@H]3[C@]1(C(=O)OC)[C@H]1C[C@H]2[C@]42O[C@@]512 |
| InChI | InChI=1S/C17H18O5/c1-20-12(18)14-8-5-9-15(14,13(19)21-2)11-7-4-3-6(10(11)14)16(8)17(7,9)22-16/h6-11H,3-5H2,1-2H3/t6-,7?,8+,9+,10-,11+,14-,15-,16-,17+/m0/s1 |
| InChIKey | HEOIBYSBMUHRQF-JCZWRZRWSA-N |
| XLogP | 0.76 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|