C10H14O5 — CID 71429976
dimethyl 6-oxabicyclo[3.2.0]heptane-7,7-dicarboxylate (PubChem CID 71429976) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is dimethyl 6-oxabicyclo[3.2.0]heptane-7,7-dicarboxylate.
| Compound Name | dimethyl 6-oxabicyclo[3.2.0]heptane-7,7-dicarboxylate |
|---|---|
| PubChem CID | 71429976 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | dimethyl 6-oxabicyclo[3.2.0]heptane-7,7-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)OC2CCCC21 |
| InChI | InChI=1S/C10H14O5/c1-13-8(11)10(9(12)14-2)6-4-3-5-7(6)15-10/h6-7H,3-5H2,1-2H3 |
| InChIKey | UFXZBJKYZDGPIY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|