methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate

C12H20O2 — CID 70465745

IUPACmethyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate
SMILESCOC(=O)C12C(C)C1CCCC2(C)C
InChIInChI=1S/C12H20O2/c1-8-9-6-5-7-11(2,3)12(8,9)10(13)14-4/h8-9H,5-7H2,1-4H3
InChIKeySLYOCLBGWILYHP-UHFFFAOYSA-N
MW196.29 g/mol
LogP2.62
Rot. Bonds1

About methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate

methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate (PubChem CID 70465745) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate.

Molecular Properties

Compound Namemethyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate
PubChem CID70465745
Molecular FormulaC12H20O2
Molecular Weight196.29 g/mol
Exact Mass196.15
IUPAC Namemethyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate
SMILESCOC(=O)C12C(C)C1CCCC2(C)C
InChIInChI=1S/C12H20O2/c1-8-9-6-5-7-11(2,3)12(8,9)10(13)14-4/h8-9H,5-7H2,1-4H3
InChIKeySLYOCLBGWILYHP-UHFFFAOYSA-N
XLogP2.62
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.29
LogP ≤ 52.62
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate?
The IUPAC name of methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate (CID 70465745) is methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate.
What is the SMILES notation for methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate?
The canonical SMILES for methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate is COC(=O)C12C(C)C1CCCC2(C)C.
What is the InChIKey of methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate?
The InChIKey is SLYOCLBGWILYHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-8-9-6-5-7-11(2,3)12(8,9)10(13)14-4/h8-9H,5-7H2,1-4H3.
What are the key properties of methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate?
methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate has a molecular weight of 196.29 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2,7-trimethylbicyclo[4.1.0]heptane-1-carboxylate is sourced from PubChem (CID 70465745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).