C19H32O2 — CID 125462842
methyl (1R,4R,4aS,4bR,8aS,10aS)-1,4,4a-trimethyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-1-carboxylate (PubChem CID 125462842) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is methyl (1R,4R,4aS,4bR,8aS,10aS)-1,4,4a-trimethyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4R,4aS,4bR,8aS,10aS)-1,4,4a-trimethyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 125462842 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | methyl (1R,4R,4aS,4bR,8aS,10aS)-1,4,4a-trimethyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC[C@@H](C)[C@@]2(C)[C@@H]3CCCC[C@H]3CC[C@@H]21 |
| InChI | InChI=1S/C19H32O2/c1-13-11-12-18(2,17(20)21-4)16-10-9-14-7-5-6-8-15(14)19(13,16)3/h13-16H,5-12H2,1-4H3/t13-,14+,15-,16-,18-,19+/m1/s1 |
| InChIKey | NPKBKGIKHKREJZ-GJWPJNNNSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |