C15H22O2 — CID 15433007
(1S,7S,8S,9S)-9-hydroxy-6,7,10,10-tetramethyltetracyclo[6.3.0.02,4.03,7]undecan-5-one (PubChem CID 15433007) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1S,7S,8S,9S)-9-hydroxy-6,7,10,10-tetramethyltetracyclo[6.3.0.02,4.03,7]undecan-5-one.
| Compound Name | (1S,7S,8S,9S)-9-hydroxy-6,7,10,10-tetramethyltetracyclo[6.3.0.02,4.03,7]undecan-5-one |
|---|---|
| PubChem CID | 15433007 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1S,7S,8S,9S)-9-hydroxy-6,7,10,10-tetramethyltetracyclo[6.3.0.02,4.03,7]undecan-5-one |
| SMILES | CC1C(=O)C2C3C4CC(C)(C)[C@@H](O)[C@@H]4[C@]1(C)C23 |
| InChI | InChI=1S/C15H22O2/c1-6-12(16)9-8-7-5-14(2,3)13(17)10(7)15(6,4)11(8)9/h6-11,13,17H,5H2,1-4H3/t6?,7?,8?,9?,10-,11?,13+,15-/m1/s1 |
| InChIKey | ZKPZXKYXUQIUGX-XZPFBZEISA-N |
| XLogP | 2.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |