About cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one
cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one (PubChem CID 91620799) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one.
Analyze cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one?
The IUPAC name of cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one (CID 91620799) is cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one.
What is the SMILES notation for cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one?
The canonical SMILES for cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one is C[C@@H]1CC(C)(O)C[C@H](C)C1=O.
What is the InChIKey of cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one?
The InChIKey is FBISYBGULVJUGP-AVSFMBPQSA-N. The full InChI is InChI=1S/C9H16O2/c1-6-4-9(3,11)5-7(2)8(6)10/h6-7,11H,4-5H2,1-3H3/t6-,7+,9?.
What are the key properties of cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one?
cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one has a molecular weight of 156.22 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2R,6S)-4-hydroxy-2,4,6-trimethylcyclohexan-1-one is sourced from PubChem (CID 91620799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).