C13H18O3 — CID 139203030
(1S,5R,7S)-1,3,3,7-tetramethylbicyclo[3.3.1]nonane-2,6,9-trione (PubChem CID 139203030) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (1S,5R,7S)-1,3,3,7-tetramethylbicyclo[3.3.1]nonane-2,6,9-trione.
| Compound Name | (1S,5R,7S)-1,3,3,7-tetramethylbicyclo[3.3.1]nonane-2,6,9-trione |
|---|---|
| PubChem CID | 139203030 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1S,5R,7S)-1,3,3,7-tetramethylbicyclo[3.3.1]nonane-2,6,9-trione |
| SMILES | C[C@H]1C[C@@]2(C)C(=O)[C@H](CC(C)(C)C2=O)C1=O |
| InChI | InChI=1S/C13H18O3/c1-7-5-13(4)10(15)8(9(7)14)6-12(2,3)11(13)16/h7-8H,5-6H2,1-4H3/t7-,8+,13-/m0/s1 |
| InChIKey | MWWXGAPKDWYVNP-DAROEXNTSA-N |
| XLogP | 1.79 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|