C8H12Cl2O — CID 130863746
trans-(2S,6S)-2,6-dichloro-4,4-dimethylcyclohexan-1-one (PubChem CID 130863746) has the molecular formula C8H12Cl2O and a molecular weight of 195.09 g/mol. Its IUPAC name is trans-(2S,6S)-2,6-dichloro-4,4-dimethylcyclohexan-1-one.
| Compound Name | trans-(2S,6S)-2,6-dichloro-4,4-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 130863746 |
| Molecular Formula | C8H12Cl2O |
| Molecular Weight | 195.09 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | trans-(2S,6S)-2,6-dichloro-4,4-dimethylcyclohexan-1-one |
| SMILES | CC1(C)C[C@H](Cl)C(=O)[C@@H](Cl)C1 |
| InChI | InChI=1S/C8H12Cl2O/c1-8(2)3-5(9)7(11)6(10)4-8/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | OFZNFGSWLLEFBV-WDSKDSINSA-N |
| XLogP | 2.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.09 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|