C14H22O — CID 11344778
(1S,3S,6S,8S)-6,10,10-trimethyltricyclo[6.3.0.03,6]undecan-2-one (PubChem CID 11344778) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (1S,3S,6S,8S)-6,10,10-trimethyltricyclo[6.3.0.03,6]undecan-2-one.
| Compound Name | (1S,3S,6S,8S)-6,10,10-trimethyltricyclo[6.3.0.03,6]undecan-2-one |
|---|---|
| PubChem CID | 11344778 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (1S,3S,6S,8S)-6,10,10-trimethyltricyclo[6.3.0.03,6]undecan-2-one |
| SMILES | CC1(C)C[C@H]2C[C@]3(C)CC[C@@H]3C(=O)[C@H]2C1 |
| InChI | InChI=1S/C14H22O/c1-13(2)6-9-7-14(3)5-4-11(14)12(15)10(9)8-13/h9-11H,4-8H2,1-3H3/t9-,10-,11+,14-/m0/s1 |
| InChIKey | CCBNUZBCYIPMBQ-DYNIEEOBSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |