C11H16O — CID 101187822
(3aS,6aR)-3,5,5-trimethyl-3a,4,6,6a-tetrahydropentalen-1-one (PubChem CID 101187822) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (3aS,6aR)-3,5,5-trimethyl-3a,4,6,6a-tetrahydropentalen-1-one.
| Compound Name | (3aS,6aR)-3,5,5-trimethyl-3a,4,6,6a-tetrahydropentalen-1-one |
|---|---|
| PubChem CID | 101187822 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (3aS,6aR)-3,5,5-trimethyl-3a,4,6,6a-tetrahydropentalen-1-one |
| SMILES | CC1=CC(=O)[C@@H]2CC(C)(C)C[C@H]12 |
| InChI | InChI=1S/C11H16O/c1-7-4-10(12)9-6-11(2,3)5-8(7)9/h4,8-9H,5-6H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | VXAGPZBLBOUIJO-RKDXNWHRSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |