About (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one
(1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one (PubChem CID 6973629) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one.
Analyze (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one?
The IUPAC name of (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one (CID 6973629) is (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one.
What is the SMILES notation for (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one?
The canonical SMILES for (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one is CC1=CC(=O)[C@H]2C[C@H]1C2(C)C.
What is the InChIKey of (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one?
The InChIKey is DCSCXTJOXBUFGB-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H14O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-8H,5H2,1-3H3/t7-,8-/m1/s1.
What are the key properties of (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one?
(1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one has a molecular weight of 150.22 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one is sourced from PubChem (CID 6973629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).