About 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one
4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one (PubChem CID 100958129) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one.
Analyze 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one?
The IUPAC name of 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one (CID 100958129) is 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one.
What is the SMILES notation for 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one?
The canonical SMILES for 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one is CC1=CC(=O)C2CCCC(O)C12.
What is the InChIKey of 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one?
The InChIKey is HYSNLERNPAVBLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-6-5-9(12)7-3-2-4-8(11)10(6)7/h5,7-8,10-11H,2-4H2,1H3.
What are the key properties of 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one?
4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one has a molecular weight of 166.22 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one is sourced from PubChem (CID 100958129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).