C17H26O3S — CID 123657491
3-cyclohexylsulfanyl-5-hydroxy-2-methyl-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione (PubChem CID 123657491) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-5-hydroxy-2-methyl-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione.
| Compound Name | 3-cyclohexylsulfanyl-5-hydroxy-2-methyl-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 123657491 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-cyclohexylsulfanyl-5-hydroxy-2-methyl-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione |
| SMILES | CC1C(=O)C2CCCC(O)C2C(=O)C1SC1CCCCC1 |
| InChI | InChI=1S/C17H26O3S/c1-10-15(19)12-8-5-9-13(18)14(12)16(20)17(10)21-11-6-3-2-4-7-11/h10-14,17-18H,2-9H2,1H3 |
| InChIKey | YAKQCXRJJRNTTP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |