C15H20O4 — CID 140883175
9,10-dioxo-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene-1-carboxylic acid (PubChem CID 140883175) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 9,10-dioxo-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene-1-carboxylic acid.
| Compound Name | 9,10-dioxo-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene-1-carboxylic acid |
|---|---|
| PubChem CID | 140883175 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 9,10-dioxo-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC2C(=O)C3CCCCC3C(=O)C12 |
| InChI | InChI=1S/C15H20O4/c16-13-8-4-1-2-5-9(8)14(17)12-10(13)6-3-7-11(12)15(18)19/h8-12H,1-7H2,(H,18,19) |
| InChIKey | ZWTXVGJRIJCCPR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |