C12H18O — CID 11401100
(3aR,7aR)-2,2,7-trimethyl-3,3a,4,7a-tetrahydro-1H-inden-5-one (PubChem CID 11401100) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (3aR,7aR)-2,2,7-trimethyl-3,3a,4,7a-tetrahydro-1H-inden-5-one.
| Compound Name | (3aR,7aR)-2,2,7-trimethyl-3,3a,4,7a-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 11401100 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (3aR,7aR)-2,2,7-trimethyl-3,3a,4,7a-tetrahydro-1H-inden-5-one |
| SMILES | CC1=CC(=O)C[C@H]2CC(C)(C)C[C@@H]12 |
| InChI | InChI=1S/C12H18O/c1-8-4-10(13)5-9-6-12(2,3)7-11(8)9/h4,9,11H,5-7H2,1-3H3/t9-,11-/m0/s1 |
| InChIKey | GSPGJGPQBIJFJD-ONGXEEELSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |