C16H18O3 — CID 16747790
(2aS,3aR,7aR,8aS)-2a,7,7a-trimethyl-2-methylidene-1,3a,4,8a-tetrahydrocyclobuta[b]naphthalene-3,5,8-trione (PubChem CID 16747790) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2aS,3aR,7aR,8aS)-2a,7,7a-trimethyl-2-methylidene-1,3a,4,8a-tetrahydrocyclobuta[b]naphthalene-3,5,8-trione.
| Compound Name | (2aS,3aR,7aR,8aS)-2a,7,7a-trimethyl-2-methylidene-1,3a,4,8a-tetrahydrocyclobuta[b]naphthalene-3,5,8-trione |
|---|---|
| PubChem CID | 16747790 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (2aS,3aR,7aR,8aS)-2a,7,7a-trimethyl-2-methylidene-1,3a,4,8a-tetrahydrocyclobuta[b]naphthalene-3,5,8-trione |
| SMILES | C=C1C[C@@H]2C(=O)[C@@]3(C)C(C)=CC(=O)C[C@H]3C(=O)[C@]12C |
| InChI | InChI=1S/C16H18O3/c1-8-5-10(17)7-12-14(19)16(4)9(2)6-11(16)13(18)15(8,12)3/h5,11-12H,2,6-7H2,1,3-4H3/t11-,12+,15+,16-/m1/s1 |
| InChIKey | QPUGURUMSYHWDC-GUYJKWIASA-N |
| XLogP | 2.26 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|