C7H10O — CID 86310528
(4S)-3,4-dimethylcyclopent-2-en-1-one (PubChem CID 86310528) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is (4S)-3,4-dimethylcyclopent-2-en-1-one.
| Compound Name | (4S)-3,4-dimethylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 86310528 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | (4S)-3,4-dimethylcyclopent-2-en-1-one |
| SMILES | CC1=CC(=O)C[C@@H]1C |
| InChI | InChI=1S/C7H10O/c1-5-3-7(8)4-6(5)2/h3,6H,4H2,1-2H3/t6-/m0/s1 |
| InChIKey | XSOSLVVAKBKYRV-LURJTMIESA-N |
| XLogP | 1.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |