C15H20O2 — CID 177472333
(3bR,6aS,7aS)-5,5,7a-trimethyl-7-oxo-1,2,3b,4,6,6a-hexahydrocyclopenta[a]pentalene-3-carbaldehyde (PubChem CID 177472333) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (3bR,6aS,7aS)-5,5,7a-trimethyl-7-oxo-1,2,3b,4,6,6a-hexahydrocyclopenta[a]pentalene-3-carbaldehyde.
| Compound Name | (3bR,6aS,7aS)-5,5,7a-trimethyl-7-oxo-1,2,3b,4,6,6a-hexahydrocyclopenta[a]pentalene-3-carbaldehyde |
|---|---|
| PubChem CID | 177472333 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3bR,6aS,7aS)-5,5,7a-trimethyl-7-oxo-1,2,3b,4,6,6a-hexahydrocyclopenta[a]pentalene-3-carbaldehyde |
| SMILES | CC1(C)C[C@@H]2C(=O)[C@@]3(C)CCC(C=O)=C3[C@@H]2C1 |
| InChI | InChI=1S/C15H20O2/c1-14(2)6-10-11(7-14)13(17)15(3)5-4-9(8-16)12(10)15/h8,10-11H,4-7H2,1-3H3/t10-,11+,15+/m1/s1 |
| InChIKey | ZBHAFZKRGWVEFI-ZETOZRRWSA-N |
| XLogP | 2.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|