C12H20O — CID 95565259
(3aR,7aR)-3a,7,7-trimethyl-2,3,4,5,6,7a-hexahydroinden-1-one (PubChem CID 95565259) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3aR,7aR)-3a,7,7-trimethyl-2,3,4,5,6,7a-hexahydroinden-1-one.
| Compound Name | (3aR,7aR)-3a,7,7-trimethyl-2,3,4,5,6,7a-hexahydroinden-1-one |
|---|---|
| PubChem CID | 95565259 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3aR,7aR)-3a,7,7-trimethyl-2,3,4,5,6,7a-hexahydroinden-1-one |
| SMILES | CC1(C)CCC[C@]2(C)CCC(=O)[C@H]12 |
| InChI | InChI=1S/C12H20O/c1-11(2)6-4-7-12(3)8-5-9(13)10(11)12/h10H,4-8H2,1-3H3/t10-,12-/m1/s1 |
| InChIKey | QFXFLIPQRDHFHM-ZYHUDNBSSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |