C11H17ClO — CID 130762291
(4aS,8aS)-1-chloro-4a-methyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 130762291) has the molecular formula C11H17ClO and a molecular weight of 200.71 g/mol. Its IUPAC name is (4aS,8aS)-1-chloro-4a-methyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (4aS,8aS)-1-chloro-4a-methyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 130762291 |
| Molecular Formula | C11H17ClO |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (4aS,8aS)-1-chloro-4a-methyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | C[C@@]12CCCC[C@@H]1C(Cl)C(=O)CC2 |
| InChI | InChI=1S/C11H17ClO/c1-11-6-3-2-4-8(11)10(12)9(13)5-7-11/h8,10H,2-7H2,1H3/t8-,10?,11+/m1/s1 |
| InChIKey | NFRCIDQQHXHBEG-WUQUSSCSSA-N |
| XLogP | 3.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|