C13H20O2 — CID 102511334
(4aS,8aR)-4a,8,8-trimethyl-2,3,4,5,7,8a-hexahydronaphthalene-1,6-dione (PubChem CID 102511334) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (4aS,8aR)-4a,8,8-trimethyl-2,3,4,5,7,8a-hexahydronaphthalene-1,6-dione.
| Compound Name | (4aS,8aR)-4a,8,8-trimethyl-2,3,4,5,7,8a-hexahydronaphthalene-1,6-dione |
|---|---|
| PubChem CID | 102511334 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (4aS,8aR)-4a,8,8-trimethyl-2,3,4,5,7,8a-hexahydronaphthalene-1,6-dione |
| SMILES | CC1(C)CC(=O)C[C@]2(C)CCCC(=O)[C@H]12 |
| InChI | InChI=1S/C13H20O2/c1-12(2)7-9(14)8-13(3)6-4-5-10(15)11(12)13/h11H,4-8H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | FRFFRAYCECSBMO-YPMHNXCESA-N |
| XLogP | 2.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |