C5H8N2OS — CID 78385770
5-methyl-4-sulfanylidene-1,3-diazinan-2-one (PubChem CID 78385770) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is 5-methyl-4-sulfanylidene-1,3-diazinan-2-one.
| Compound Name | 5-methyl-4-sulfanylidene-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 78385770 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 5-methyl-4-sulfanylidene-1,3-diazinan-2-one |
| SMILES | CC1CNC(=O)NC1=S |
| InChI | InChI=1S/C5H8N2OS/c1-3-2-6-5(8)7-4(3)9/h3H,2H2,1H3,(H2,6,7,8,9) |
| InChIKey | ALHGBFJCZAKZAE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|