C7H11N3O3 — CID 170579335
N-methyl-2,7-dioxo-1,3-diazepane-5-carboxamide (PubChem CID 170579335) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is N-methyl-2,7-dioxo-1,3-diazepane-5-carboxamide.
| Compound Name | N-methyl-2,7-dioxo-1,3-diazepane-5-carboxamide |
|---|---|
| PubChem CID | 170579335 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | N-methyl-2,7-dioxo-1,3-diazepane-5-carboxamide |
| SMILES | CNC(=O)C1CNC(=O)NC(=O)C1 |
| InChI | InChI=1S/C7H11N3O3/c1-8-6(12)4-2-5(11)10-7(13)9-3-4/h4H,2-3H2,1H3,(H,8,12)(H2,9,10,11,13) |
| InChIKey | LTCXOPSIGLHAHI-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |