C5H8N2O2 — CID 10654245
5-methyl-(213C,1,3-14N2)1,3-diazinane-2,4-dione (PubChem CID 10654245) has the molecular formula C5H8N2O2 and a molecular weight of 129.12 g/mol. Its IUPAC name is 5-methyl-(213C,1,3-14N2)1,3-diazinane-2,4-dione.
| Compound Name | 5-methyl-(213C,1,3-14N2)1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 10654245 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 5-methyl-(213C,1,3-14N2)1,3-diazinane-2,4-dione |
| SMILES | CC1C[14NH][13C](=O)[14NH]C1=O |
| InChI | InChI=1S/C5H8N2O2/c1-3-2-6-5(9)7-4(3)8/h3H,2H2,1H3,(H2,6,7,8,9)/i5+1,6+0,7+0 |
| InChIKey | NBAKTGXDIBVZOO-XLQIKJPQSA-N |
| XLogP | -0.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |