C6H11N3O2 — CID 45036964
5-(ethylamino)-1,3-diazinane-2,4-dione (PubChem CID 45036964) has the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-(ethylamino)-1,3-diazinane-2,4-dione.
| Compound Name | 5-(ethylamino)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 45036964 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 5-(ethylamino)-1,3-diazinane-2,4-dione |
| SMILES | CCNC1CNC(=O)NC1=O |
| InChI | InChI=1S/C6H11N3O2/c1-2-7-4-3-8-6(11)9-5(4)10/h4,7H,2-3H2,1H3,(H2,8,9,10,11) |
| InChIKey | BGAZSYWAEWQTNI-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |