C12H16N2O — CID 14627274
3-(ethylamino)-8-methyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 14627274) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-(ethylamino)-8-methyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 3-(ethylamino)-8-methyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 14627274 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-(ethylamino)-8-methyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCNC1Cc2cccc(C)c2NC1=O |
| InChI | InChI=1S/C12H16N2O/c1-3-13-10-7-9-6-4-5-8(2)11(9)14-12(10)15/h4-6,10,13H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | WMUQFODVWVWPEZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |