C4H7BN2O4 — CID 99773061
[(5S)-2,4-dioxo-1,3-diazinan-5-yl]boronic acid (PubChem CID 99773061) has the molecular formula C4H7BN2O4 and a molecular weight of 157.92 g/mol. Its IUPAC name is [(5S)-2,4-dioxo-1,3-diazinan-5-yl]boronic acid.
| Compound Name | [(5S)-2,4-dioxo-1,3-diazinan-5-yl]boronic acid |
|---|---|
| PubChem CID | 99773061 |
| Molecular Formula | C4H7BN2O4 |
| Molecular Weight | 157.92 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | [(5S)-2,4-dioxo-1,3-diazinan-5-yl]boronic acid |
| SMILES | O=C1NC[C@H](B(O)O)C(=O)N1 |
| InChI | InChI=1S/C4H7BN2O4/c8-3-2(5(10)11)1-6-4(9)7-3/h2,10-11H,1H2,(H2,6,7,8,9)/t2-/m0/s1 |
| InChIKey | YKAVSUODMYWPJB-REOHCLBHSA-N |
| XLogP | -2.33 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.92 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|