C10H11N3O2S — CID 78235617
5-(2-aminophenyl)sulfanyl-1,3-diazinane-2,4-dione (PubChem CID 78235617) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 5-(2-aminophenyl)sulfanyl-1,3-diazinane-2,4-dione.
| Compound Name | 5-(2-aminophenyl)sulfanyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 78235617 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-(2-aminophenyl)sulfanyl-1,3-diazinane-2,4-dione |
| SMILES | Nc1ccccc1SC1CNC(=O)NC1=O |
| InChI | InChI=1S/C10H11N3O2S/c11-6-3-1-2-4-7(6)16-8-5-12-10(15)13-9(8)14/h1-4,8H,5,11H2,(H2,12,13,14,15) |
| InChIKey | KCXLSYOJGASEPE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|