C17H18N2OS — CID 103313700
3-(2-amino-5-methylphenyl)sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 103313700) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-(2-amino-5-methylphenyl)sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-(2-amino-5-methylphenyl)sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 103313700 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-(2-amino-5-methylphenyl)sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | Cc1ccc(N)c(SC2CCc3ccccc3NC2=O)c1 |
| InChI | InChI=1S/C17H18N2OS/c1-11-6-8-13(18)16(10-11)21-15-9-7-12-4-2-3-5-14(12)19-17(15)20/h2-6,8,10,15H,7,9,18H2,1H3,(H,19,20) |
| InChIKey | IYKKAVPBBRUFSD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|