C13H14N6OS — CID 124623256
(3S)-3-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 124623256) has the molecular formula C13H14N6OS and a molecular weight of 302.36 g/mol. Its IUPAC name is (3S)-3-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3S)-3-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 124623256 |
| Molecular Formula | C13H14N6OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (3S)-3-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | Nc1nc(N)nc(S[C@H]2CCc3ccccc3NC2=O)n1 |
| InChI | InChI=1S/C13H14N6OS/c14-11-17-12(15)19-13(18-11)21-9-6-5-7-3-1-2-4-8(7)16-10(9)20/h1-4,9H,5-6H2,(H,16,20)(H4,14,15,17,18,19)/t9-/m0/s1 |
| InChIKey | IETGIXCHUZSWRA-VIFPVBQESA-N |
| XLogP | 1.08 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |