C15H13N5OS — CID 100702462
(3R)-3-(7H-purin-8-ylsulfanyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 100702462) has the molecular formula C15H13N5OS and a molecular weight of 311.37 g/mol. Its IUPAC name is (3R)-3-(7H-purin-8-ylsulfanyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3R)-3-(7H-purin-8-ylsulfanyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 100702462 |
| Molecular Formula | C15H13N5OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (3R)-3-(7H-purin-8-ylsulfanyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CC[C@H]1Sc1nc2ncncc2[nH]1 |
| InChI | InChI=1S/C15H13N5OS/c21-14-12(6-5-9-3-1-2-4-10(9)18-14)22-15-19-11-7-16-8-17-13(11)20-15/h1-4,7-8,12H,5-6H2,(H,18,21)(H,16,17,19,20)/t12-/m1/s1 |
| InChIKey | GEMITBCFIUAPNI-GFCCVEGCSA-N |
| XLogP | 2.40 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |