C19H15N5OS — CID 134066913
3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 134066913) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is 3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 134066913 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CCC1Sc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C19H15N5OS/c25-18-15(10-9-11-5-1-3-7-13(11)21-18)26-19-22-17-16(23-24-19)12-6-2-4-8-14(12)20-17/h1-8,15H,9-10H2,(H,21,25)(H,20,22,24) |
| InChIKey | QHIPPBASRNNLKC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |