C14H13F3N4OS — CID 124619863
(3R)-3-[[4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 124619863) has the molecular formula C14H13F3N4OS and a molecular weight of 342.35 g/mol. Its IUPAC name is (3R)-3-[[4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3R)-3-[[4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 124619863 |
| Molecular Formula | C14H13F3N4OS |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (3R)-3-[[4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CC[C@H]1Sc1nncn1CC(F)(F)F |
| InChI | InChI=1S/C14H13F3N4OS/c15-14(16,17)7-21-8-18-20-13(21)23-11-6-5-9-3-1-2-4-10(9)19-12(11)22/h1-4,8,11H,5-7H2,(H,19,22)/t11-/m1/s1 |
| InChIKey | RVJXGJVLQQRKEG-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |