C24H26N4OS — CID 39343052
(3R)-3-[(4-cyclohexyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 39343052) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is (3R)-3-[(4-cyclohexyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3R)-3-[(4-cyclohexyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 39343052 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (3R)-3-[(4-cyclohexyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CC[C@H]1Sc1nnc(-c2ccccc2)n1C1CCCCC1 |
| InChI | InChI=1S/C24H26N4OS/c29-23-21(16-15-17-9-7-8-14-20(17)25-23)30-24-27-26-22(18-10-3-1-4-11-18)28(24)19-12-5-2-6-13-19/h1,3-4,7-11,14,19,21H,2,5-6,12-13,15-16H2,(H,25,29)/t21-/m1/s1 |
| InChIKey | IGMAIRKWPBPFOK-OAQYLSRUSA-N |
| XLogP | 5.50 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |