C24H26N4O2S — CID 135902845
(3R)-3-[[4-cyclohexyl-5-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 135902845) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is (3R)-3-[[4-cyclohexyl-5-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3R)-3-[[4-cyclohexyl-5-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 135902845 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (3R)-3-[[4-cyclohexyl-5-(4-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CC[C@H]1Sc1nnc(-c2ccc(O)cc2)n1C1CCCCC1 |
| InChI | InChI=1S/C24H26N4O2S/c29-19-13-10-17(11-14-19)22-26-27-24(28(22)18-7-2-1-3-8-18)31-21-15-12-16-6-4-5-9-20(16)25-23(21)30/h4-6,9-11,13-14,18,21,29H,1-3,7-8,12,15H2,(H,25,30)/t21-/m1/s1 |
| InChIKey | YGJRAXDHGDKLRG-OAQYLSRUSA-N |
| XLogP | 5.20 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |