C14H13N5 — CID 106902586
3-(7H-purin-8-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106902586) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-(7H-purin-8-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(7H-purin-8-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106902586 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-(7H-purin-8-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)CC(c1nc3ncncc3[nH]1)CN2 |
| InChI | InChI=1S/C14H13N5/c1-2-4-11-9(3-1)5-10(6-16-11)13-18-12-7-15-8-17-14(12)19-13/h1-4,7-8,10,16H,5-6H2,(H,15,17,18,19) |
| InChIKey | YZNBOILLUZTWIG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |