C21H19N — CID 101408194
3-(4-phenylphenyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 101408194) has the molecular formula C21H19N and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(4-phenylphenyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 101408194 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-(4-phenylphenyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc(-c2ccc(C3CNc4ccccc4C3)cc2)cc1 |
| InChI | InChI=1S/C21H19N/c1-2-6-16(7-3-1)17-10-12-18(13-11-17)20-14-19-8-4-5-9-21(19)22-15-20/h1-13,20,22H,14-15H2 |
| InChIKey | KXQXIKSPOZFMEO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |