C11H12N4 — CID 106903175
3-(1H-1,2,4-triazol-5-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106903175) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(1H-1,2,4-triazol-5-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106903175 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)CC(c1ncn[nH]1)CN2 |
| InChI | InChI=1S/C11H12N4/c1-2-4-10-8(3-1)5-9(6-12-10)11-13-7-14-15-11/h1-4,7,9,12H,5-6H2,(H,13,14,15) |
| InChIKey | FIRUIVGXSCAVCL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |