C13H13NS — CID 42080152
(3S)-3-thiophen-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 42080152) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is (3S)-3-thiophen-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (3S)-3-thiophen-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 42080152 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (3S)-3-thiophen-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | c1csc([C@@H]2CNc3ccccc3C2)c1 |
| InChI | InChI=1S/C13H13NS/c1-2-5-12-10(4-1)8-11(9-14-12)13-6-3-7-15-13/h1-7,11,14H,8-9H2/t11-/m0/s1 |
| InChIKey | DXMLIDCRXYTMAO-NSHDSACASA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |