C13H10N4O2 — CID 114402597
8-(2,3-dihydro-1,4-benzodioxin-3-yl)-7H-purine (PubChem CID 114402597) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 8-(2,3-dihydro-1,4-benzodioxin-3-yl)-7H-purine.
| Compound Name | 8-(2,3-dihydro-1,4-benzodioxin-3-yl)-7H-purine |
|---|---|
| PubChem CID | 114402597 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 8-(2,3-dihydro-1,4-benzodioxin-3-yl)-7H-purine |
| SMILES | c1ccc2c(c1)OCC(c1nc3ncncc3[nH]1)O2 |
| InChI | InChI=1S/C13H10N4O2/c1-2-4-10-9(3-1)18-6-11(19-10)13-16-8-5-14-7-15-12(8)17-13/h1-5,7,11H,6H2,(H,14,15,16,17) |
| InChIKey | VDHNKZMTSZIFFY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |