C16H15BrN2OS — CID 103313711
3-(4-amino-2-bromophenyl)sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 103313711) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is 3-(4-amino-2-bromophenyl)sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-(4-amino-2-bromophenyl)sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 103313711 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 3-(4-amino-2-bromophenyl)sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | Nc1ccc(SC2CCc3ccccc3NC2=O)c(Br)c1 |
| InChI | InChI=1S/C16H15BrN2OS/c17-12-9-11(18)6-8-14(12)21-15-7-5-10-3-1-2-4-13(10)19-16(15)20/h1-4,6,8-9,15H,5,7,18H2,(H,19,20) |
| InChIKey | ONDBILQJJJSPDO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|